CID 21540195
2-chloro-8-methylquinoline
Structural Information
- Molecular Formula
- C10H8ClN
- SMILES
- CC1=C2C(=CC=C1)C=CC(=N2)Cl
- InChI
- InChI=1S/C10H8ClN/c1-7-3-2-4-8-5-6-9(11)12-10(7)8/h2-6H,1H3
- InChIKey
- ZLKRFLIUXVCYKM-UHFFFAOYSA-N
- Compound name
- 2-chloro-8-methylquinoline
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 178.04181 | 132.5 |
| [M+Na]+ | 200.02375 | 143.7 |
| [M-H]- | 176.02725 | 136.1 |
| [M+NH4]+ | 195.06835 | 153.8 |
| [M+K]+ | 215.99769 | 138.8 |
| [M+H-H2O]+ | 160.03179 | 126.9 |
| [M+HCOO]- | 222.03273 | 150.7 |
| [M+CH3COO]- | 236.04838 | 146.9 |
| [M+Na-2H]- | 198.00920 | 141.7 |
| [M]+ | 177.03398 | 134.8 |
| [M]- | 177.03508 | 134.8 |