CID 213031
Fenhexamid
Structural Information
- Molecular Formula
- C14H17Cl2NO2
- SMILES
- CC1(CCCCC1)C(=O)NC2=C(C(=C(C=C2)O)Cl)Cl
- InChI
- InChI=1S/C14H17Cl2NO2/c1-14(7-3-2-4-8-14)13(19)17-9-5-6-10(18)12(16)11(9)15/h5-6,18H,2-4,7-8H2,1H3,(H,17,19)
- InChIKey
- VDLGAVXLJYLFDH-UHFFFAOYSA-N
- Compound name
- N-(2,3-dichloro-4-hydroxyphenyl)-1-methylcyclohexane-1-carboxamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 302.07091 | 164.7 |
| [M+Na]+ | 324.05285 | 172.0 |
| [M-H]- | 300.05635 | 169.2 |
| [M+NH4]+ | 319.09745 | 182.3 |
| [M+K]+ | 340.02679 | 166.0 |
| [M+H-H2O]+ | 284.06089 | 160.4 |
| [M+HCOO]- | 346.06183 | 174.6 |
| [M+CH3COO]- | 360.07748 | 200.1 |
| [M+Na-2H]- | 322.03830 | 166.5 |
| [M]+ | 301.06308 | 163.5 |
| [M]- | 301.06418 | 163.5 |