CID 21121819
Ecdysone 22-phosphate
Structural Information
- Molecular Formula
- C27H45O9P
- SMILES
- C[C@@H]([C@H]1CC[C@@]2([C@@]1(CC[C@H]3C2=CC(=O)[C@H]4[C@@]3(C[C@@H]([C@@H](C4)O)O)C)C)O)[C@@H](CCC(C)(C)O)OP(=O)(O)O
- InChI
- InChI=1S/C27H45O9P/c1-15(23(36-37(33,34)35)8-9-24(2,3)31)16-7-11-27(32)18-12-20(28)19-13-21(29)22(30)14-25(19,4)17(18)6-10-26(16,27)5/h12,15-17,19,21-23,29-32H,6-11,13-14H2,1-5H3,(H2,33,34,35)/t15-,16+,17-,19-,21+,22-,23+,25+,26+,27+/m0/s1
- InChIKey
- FUMILPJJVXGPIT-LAMJOLGYSA-N
- Compound name
- [(2S,3R)-6-hydroxy-6-methyl-2-[(2S,3R,5R,9R,10R,13R,14S,17R)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-3-yl] dihydrogen phosphate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 545.28738 | 228.5 |
| [M+Na]+ | 567.26932 | 228.6 |
| [M-H]- | 543.27282 | 222.4 |
| [M+NH4]+ | 562.31392 | 240.2 |
| [M+K]+ | 583.24326 | 227.4 |
| [M+H-H2O]+ | 527.27736 | 225.4 |
| [M+HCOO]- | 589.27830 | 228.1 |
| [M+CH3COO]- | 603.29395 | 242.1 |
| [M+Na-2H]- | 565.25477 | 227.3 |
| [M]+ | 544.27955 | 225.6 |
| [M]- | 544.28065 | 225.6 |