CID 20552
Alizarine blue bl
Structural Information
- Molecular Formula
- C32H30N2O8S2
- SMILES
- CC1=CC(=C(C(=C1NC2=C3C(=C(C=C2)NC4=C(C(=C(C=C4C)C)S(=O)(=O)O)C)C(=O)C5=CC=CC=C5C3=O)C)S(=O)(=O)O)C
- InChI
- InChI=1S/C32H30N2O8S2/c1-15-13-17(3)31(43(37,38)39)19(5)27(15)33-23-11-12-24(26-25(23)29(35)21-9-7-8-10-22(21)30(26)36)34-28-16(2)14-18(4)32(20(28)6)44(40,41)42/h7-14,33-34H,1-6H3,(H,37,38,39)(H,40,41,42)
- InChIKey
- ZATHVTMEPLUQKK-UHFFFAOYSA-N
- Compound name
- 3-[[9,10-dioxo-4-(2,4,6-trimethyl-3-sulfoanilino)anthracen-1-yl]amino]-2,4,6-trimethylbenzenesulfonic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 635.15163 | 245.6 |
| [M+Na]+ | 657.13357 | 251.5 |
| [M-H]- | 633.13707 | 252.7 |
| [M+NH4]+ | 652.17817 | 246.9 |
| [M+K]+ | 673.10751 | 246.8 |
| [M+H-H2O]+ | 617.14161 | 235.9 |
| [M+HCOO]- | 679.14255 | 249.4 |
| [M+CH3COO]- | 693.15820 | 271.9 |
| [M+Na-2H]- | 655.11902 | 248.9 |
| [M]+ | 634.14380 | 253.1 |
| [M]- | 634.14490 | 253.1 |