CID 19995976
1461726-89-5
Structural Information
- Molecular Formula
- C9H9NO2
- SMILES
- CC1=C(N=CC=C1)/C=C/C(=O)O
- InChI
- InChI=1S/C9H9NO2/c1-7-3-2-6-10-8(7)4-5-9(11)12/h2-6H,1H3,(H,11,12)/b5-4+
- InChIKey
- BTBTVPAYRMOTBK-SNAWJCMRSA-N
- Compound name
- (E)-3-(3-methylpyridin-2-yl)prop-2-enoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 164.07060 | 132.7 |
| [M+Na]+ | 186.05254 | 141.0 |
| [M-H]- | 162.05604 | 133.9 |
| [M+NH4]+ | 181.09714 | 151.5 |
| [M+K]+ | 202.02648 | 138.4 |
| [M+H-H2O]+ | 146.06058 | 126.6 |
| [M+HCOO]- | 208.06152 | 154.4 |
| [M+CH3COO]- | 222.07717 | 174.9 |
| [M+Na-2H]- | 184.03799 | 138.6 |
| [M]+ | 163.06277 | 132.4 |
| [M]- | 163.06387 | 132.4 |