CID 189916
6-(dimethylamino)-9-(4-methylbenzyl)-2-(trifluoromethyl)-9h-purine
Structural Information
- Molecular Formula
- C16H16F3N5
- SMILES
- CC1=CC=C(C=C1)CN2C=NC3=C2N=C(N=C3N(C)C)C(F)(F)F
- InChI
- InChI=1S/C16H16F3N5/c1-10-4-6-11(7-5-10)8-24-9-20-12-13(23(2)3)21-15(16(17,18)19)22-14(12)24/h4-7,9H,8H2,1-3H3
- InChIKey
- CGYQALAEDMYLCQ-UHFFFAOYSA-N
- Compound name
- N,N-dimethyl-9-[(4-methylphenyl)methyl]-2-(trifluoromethyl)purin-6-amine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 336.14305 | 178.0 |
| [M+Na]+ | 358.12499 | 189.7 |
| [M-H]- | 334.12849 | 179.2 |
| [M+NH4]+ | 353.16959 | 190.1 |
| [M+K]+ | 374.09893 | 183.8 |
| [M+H-H2O]+ | 318.13303 | 165.3 |
| [M+HCOO]- | 380.13397 | 194.9 |
| [M+CH3COO]- | 394.14962 | 216.7 |
| [M+Na-2H]- | 356.11044 | 182.0 |
| [M]+ | 335.13522 | 179.2 |
| [M]- | 335.13632 | 179.2 |