CID 18519
Tetrahydropapaveroline
Structural Information
- Molecular Formula
- C16H17NO4
- SMILES
- C1CNC(C2=CC(=C(C=C21)O)O)CC3=CC(=C(C=C3)O)O
- InChI
- InChI=1S/C16H17NO4/c18-13-2-1-9(6-14(13)19)5-12-11-8-16(21)15(20)7-10(11)3-4-17-12/h1-2,6-8,12,17-21H,3-5H2
- InChIKey
- ABXZOXDTHTTZJW-UHFFFAOYSA-N
- Compound name
- 1-[(3,4-dihydroxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 288.12303 | 165.6 |
| [M+Na]+ | 310.10497 | 172.7 |
| [M-H]- | 286.10847 | 165.6 |
| [M+NH4]+ | 305.14957 | 177.8 |
| [M+K]+ | 326.07891 | 166.4 |
| [M+H-H2O]+ | 270.11301 | 158.6 |
| [M+HCOO]- | 332.11395 | 178.0 |
| [M+CH3COO]- | 346.12960 | 174.6 |
| [M+Na-2H]- | 308.09042 | 168.2 |
| [M]+ | 287.11520 | 160.6 |
| [M]- | 287.11630 | 160.6 |