CID 18320
N,n'-bis(1,4-dimethylpentyl)-p-phenylenediamine
Structural Information
- Molecular Formula
- C20H36N2
- SMILES
- CC(C)CCC(C)NC1=CC=C(C=C1)NC(C)CCC(C)C
- InChI
- InChI=1S/C20H36N2/c1-15(2)7-9-17(5)21-19-11-13-20(14-12-19)22-18(6)10-8-16(3)4/h11-18,21-22H,7-10H2,1-6H3
- InChIKey
- ZJNLYGOUHDJHMG-UHFFFAOYSA-N
- Compound name
- 1-N,4-N-bis(5-methylhexan-2-yl)benzene-1,4-diamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 305.29512 | 184.3 |
| [M+Na]+ | 327.27706 | 185.2 |
| [M-H]- | 303.28056 | 186.3 |
| [M+NH4]+ | 322.32166 | 198.6 |
| [M+K]+ | 343.25100 | 182.6 |
| [M+H-H2O]+ | 287.28510 | 176.4 |
| [M+HCOO]- | 349.28604 | 203.1 |
| [M+CH3COO]- | 363.30169 | 218.9 |
| [M+Na-2H]- | 325.26251 | 181.3 |
| [M]+ | 304.28729 | 184.5 |
| [M]- | 304.28839 | 184.5 |