CID 17805
2827-47-6
Structural Information
- Molecular Formula
- C7H14N6
- SMILES
- CN(C)C1=NC(=NC(=N1)N)N(C)C
- InChI
- InChI=1S/C7H14N6/c1-12(2)6-9-5(8)10-7(11-6)13(3)4/h1-4H3,(H2,8,9,10,11)
- InChIKey
- LVVRSRYXKCKALW-UHFFFAOYSA-N
- Compound name
- 2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 183.13527 | 141.3 |
| [M+Na]+ | 205.11721 | 149.4 |
| [M-H]- | 181.12071 | 144.0 |
| [M+NH4]+ | 200.16181 | 157.8 |
| [M+K]+ | 221.09115 | 149.6 |
| [M+H-H2O]+ | 165.12525 | 132.3 |
| [M+HCOO]- | 227.12619 | 166.1 |
| [M+CH3COO]- | 241.14184 | 196.9 |
| [M+Na-2H]- | 203.10266 | 147.9 |
| [M]+ | 182.12744 | 142.1 |
| [M]- | 182.12854 | 142.1 |