CID 16640686
3-(2-methoxyethoxy)aniline
Structural Information
- Molecular Formula
- C9H13NO2
- SMILES
- COCCOC1=CC=CC(=C1)N
- InChI
- InChI=1S/C9H13NO2/c1-11-5-6-12-9-4-2-3-8(10)7-9/h2-4,7H,5-6,10H2,1H3
- InChIKey
- RNNUSMIPHMAFKN-UHFFFAOYSA-N
- Compound name
- 3-(2-methoxyethoxy)aniline
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 168.10192 | 134.3 |
| [M+Na]+ | 190.08386 | 141.8 |
| [M-H]- | 166.08736 | 137.6 |
| [M+NH4]+ | 185.12846 | 154.6 |
| [M+K]+ | 206.05780 | 140.5 |
| [M+H-H2O]+ | 150.09190 | 128.3 |
| [M+HCOO]- | 212.09284 | 159.8 |
| [M+CH3COO]- | 226.10849 | 180.6 |
| [M+Na-2H]- | 188.06931 | 141.1 |
| [M]+ | 167.09409 | 135.8 |
| [M]- | 167.09519 | 135.8 |