CID 16061139
7s,17s-dihydroxy-5z,8e,10z,13z,15e,19z-docosahexaenoic acid
Structural Information
- Molecular Formula
- C22H32O4
- SMILES
- CC/C=C\C[C@@H](/C=C/C=C\C/C=C\C=C\[C@H](/C=C\CCCC(=O)O)O)O
- InChI
- InChI=1S/C22H32O4/c1-2-3-10-15-20(23)16-11-7-5-4-6-8-12-17-21(24)18-13-9-14-19-22(25)26/h3,5-8,10-13,16-18,20-21,23-24H,2,4,9,14-15,19H2,1H3,(H,25,26)/b7-5-,8-6-,10-3-,16-11+,17-12+,18-13-/t20-,21+/m0/s1
- InChIKey
- JBRPFYYLEQERPG-XTIXYJHRSA-N
- Compound name
- (5Z,7S,8E,10Z,13Z,15E,17S,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 361.23735 | 195.5 |
| [M+Na]+ | 383.21929 | 196.5 |
| [M-H]- | 359.22279 | 189.1 |
| [M+NH4]+ | 378.26389 | 189.7 |
| [M+K]+ | 399.19323 | 188.8 |
| [M+H-H2O]+ | 343.22733 | 189.2 |
| [M+HCOO]- | 405.22827 | 199.1 |
| [M+CH3COO]- | 419.24392 | 208.2 |
| [M+Na-2H]- | 381.20474 | 189.2 |
| [M]+ | 360.22952 | 195.5 |
| [M]- | 360.23062 | 195.5 |