CID 15937385
115142-66-0
Structural Information
- Molecular Formula
- C20H22O8
- SMILES
- C1=CC(=C(C(=C1)OCCOCCOCCOC2=CC=CC(=C2O)C=O)O)C=O
- InChI
- InChI=1S/C20H22O8/c21-13-15-3-1-5-17(19(15)23)27-11-9-25-7-8-26-10-12-28-18-6-2-4-16(14-22)20(18)24/h1-6,13-14,23-24H,7-12H2
- InChIKey
- ISEWYTMBYAEVRZ-UHFFFAOYSA-N
- Compound name
- 3-[2-[2-[2-(3-formyl-2-hydroxyphenoxy)ethoxy]ethoxy]ethoxy]-2-hydroxybenzaldehyde
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 391.13875 | 187.2 |
| [M+Na]+ | 413.12069 | 193.1 |
| [M-H]- | 389.12419 | 190.9 |
| [M+NH4]+ | 408.16529 | 196.9 |
| [M+K]+ | 429.09463 | 190.5 |
| [M+H-H2O]+ | 373.12873 | 177.9 |
| [M+HCOO]- | 435.12967 | 208.2 |
| [M+CH3COO]- | 449.14532 | 215.2 |
| [M+Na-2H]- | 411.10614 | 188.9 |
| [M]+ | 390.13092 | 196.2 |
| [M]- | 390.13202 | 196.2 |