CID 155875
2-(5-methylfuran-2-yl)acetic acid
Structural Information
- Molecular Formula
- C7H8O3
- SMILES
- CC1=CC=C(O1)CC(=O)O
- InChI
- InChI=1S/C7H8O3/c1-5-2-3-6(10-5)4-7(8)9/h2-3H,4H2,1H3,(H,8,9)
- InChIKey
- TZRHDOORWZCBGT-UHFFFAOYSA-N
- Compound name
- 2-(5-methylfuran-2-yl)acetic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 141.05463 | 125.5 |
| [M+Na]+ | 163.03657 | 134.2 |
| [M-H]- | 139.04007 | 129.0 |
| [M+NH4]+ | 158.08117 | 147.1 |
| [M+K]+ | 179.01051 | 134.3 |
| [M+H-H2O]+ | 123.04461 | 121.0 |
| [M+HCOO]- | 185.04555 | 148.9 |
| [M+CH3COO]- | 199.06120 | 169.8 |
| [M+Na-2H]- | 161.02202 | 131.2 |
| [M]+ | 140.04680 | 127.4 |
| [M]- | 140.04790 | 127.4 |