CID 14985839
1-benzyl-1h-pyrrole-2-carboxylic acid
Structural Information
- Molecular Formula
- C12H11NO2
- SMILES
- C1=CC=C(C=C1)CN2C=CC=C2C(=O)O
- InChI
- InChI=1S/C12H11NO2/c14-12(15)11-7-4-8-13(11)9-10-5-2-1-3-6-10/h1-8H,9H2,(H,14,15)
- InChIKey
- OGGDCEFWAMGBOB-UHFFFAOYSA-N
- Compound name
- 1-benzylpyrrole-2-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 202.08626 | 142.7 |
| [M+Na]+ | 224.06820 | 150.5 |
| [M-H]- | 200.07170 | 147.1 |
| [M+NH4]+ | 219.11280 | 161.3 |
| [M+K]+ | 240.04214 | 147.3 |
| [M+H-H2O]+ | 184.07624 | 135.6 |
| [M+HCOO]- | 246.07718 | 165.4 |
| [M+CH3COO]- | 260.09283 | 181.1 |
| [M+Na-2H]- | 222.05365 | 146.9 |
| [M]+ | 201.07843 | 142.4 |
| [M]- | 201.07953 | 142.4 |