CID 147311
Indoline-5,6-diol
Structural Information
- Molecular Formula
- C8H9NO2
- SMILES
- C1CNC2=CC(=C(C=C21)O)O
- InChI
- InChI=1S/C8H9NO2/c10-7-3-5-1-2-9-6(5)4-8(7)11/h3-4,9-11H,1-2H2
- InChIKey
- VGSVNUGKHOVSPK-UHFFFAOYSA-N
- Compound name
- 2,3-dihydro-1H-indole-5,6-diol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 152.07060 | 129.1 |
| [M+Na]+ | 174.05254 | 137.8 |
| [M-H]- | 150.05604 | 128.7 |
| [M+NH4]+ | 169.09714 | 150.1 |
| [M+K]+ | 190.02648 | 134.0 |
| [M+H-H2O]+ | 134.06058 | 124.2 |
| [M+HCOO]- | 196.06152 | 147.8 |
| [M+CH3COO]- | 210.07717 | 167.3 |
| [M+Na-2H]- | 172.03799 | 134.8 |
| [M]+ | 151.06277 | 125.4 |
| [M]- | 151.06387 | 125.4 |