CID 14722130
775545-30-7
Structural Information
- Molecular Formula
- C7H7NO3
- SMILES
- C1=CC(=NC=C1C(=O)O)CO
- InChI
- InChI=1S/C7H7NO3/c9-4-6-2-1-5(3-8-6)7(10)11/h1-3,9H,4H2,(H,10,11)
- InChIKey
- HJDYJONTIWRYOB-UHFFFAOYSA-N
- Compound name
- 6-(hydroxymethyl)pyridine-3-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 154.04987 | 128.4 |
| [M+Na]+ | 176.03181 | 136.7 |
| [M-H]- | 152.03531 | 128.4 |
| [M+NH4]+ | 171.07641 | 146.8 |
| [M+K]+ | 192.00575 | 134.7 |
| [M+H-H2O]+ | 136.03985 | 122.6 |
| [M+HCOO]- | 198.04079 | 149.2 |
| [M+CH3COO]- | 212.05644 | 169.9 |
| [M+Na-2H]- | 174.01726 | 134.8 |
| [M]+ | 153.04204 | 127.7 |
| [M]- | 153.04314 | 127.7 |