CID 14311158
Delphinidin 3-o-(6''-o-malonyl)-beta-d-glucoside
Structural Information
- Molecular Formula
- C24H23O15
- SMILES
- C1=C(C=C(C(=C1O)O)O)C2=[O+]C3=CC(=CC(=C3C=C2O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)CC(=O)O)O)O)O)O)O
- InChI
- InChI=1S/C24H22O15/c25-9-3-11(26)10-5-15(23(37-14(10)4-9)8-1-12(27)19(32)13(28)2-8)38-24-22(35)21(34)20(33)16(39-24)7-36-18(31)6-17(29)30/h1-5,16,20-22,24,33-35H,6-7H2,(H5-,25,26,27,28,29,30,32)/p+1/t16-,20-,21+,22-,24-/m1/s1
- InChIKey
- FNFHDAUGLIPVPU-XQKZCQIMSA-O
- Compound name
- 3-[[(2R,3S,4S,5R,6S)-6-[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-3-oxopropanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 552.11098 | 222.6 |
| [M+Na]+ | 574.09292 | 228.2 |
| [M-H]- | 550.09642 | 219.4 |
| [M+NH4]+ | 569.13752 | 225.5 |
| [M+K]+ | 590.06686 | 222.4 |
| [M+H-H2O]+ | 534.10096 | 213.6 |
| [M+HCOO]- | 596.10190 | 227.6 |
| [M+CH3COO]- | 610.11755 | 234.6 |
| [M+Na-2H]- | 572.07837 | 246.5 |
| [M]+ | 551.10315 | 246.0 |
| [M]- | 551.10425 | 246.0 |