CID 138978589
1,3-dioxoisoindolin-2-yl cyclopentanecarboxylate
Structural Information
- Molecular Formula
- C14H13NO4
- SMILES
- C1CCC(C1)C(=O)ON2C(=O)C3=CC=CC=C3C2=O
- InChI
- InChI=1S/C14H13NO4/c16-12-10-7-3-4-8-11(10)13(17)15(12)19-14(18)9-5-1-2-6-9/h3-4,7-9H,1-2,5-6H2
- InChIKey
- ZLUFXIZISRCDHH-UHFFFAOYSA-N
- Compound name
- (1,3-dioxoisoindol-2-yl) cyclopentanecarboxylate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 260.09175 | 156.8 |
| [M+Na]+ | 282.07369 | 164.4 |
| [M-H]- | 258.07719 | 163.3 |
| [M+NH4]+ | 277.11829 | 176.5 |
| [M+K]+ | 298.04763 | 161.8 |
| [M+H-H2O]+ | 242.08173 | 150.4 |
| [M+HCOO]- | 304.08267 | 177.2 |
| [M+CH3COO]- | 318.09832 | 192.9 |
| [M+Na-2H]- | 280.05914 | 156.6 |
| [M]+ | 259.08392 | 156.6 |
| [M]- | 259.08502 | 156.6 |