CID 138939
1-nitro-2-propylbenzene
Structural Information
- Molecular Formula
- C9H11NO2
- SMILES
- CCCC1=CC=CC=C1[N+](=O)[O-]
- InChI
- InChI=1S/C9H11NO2/c1-2-5-8-6-3-4-7-9(8)10(11)12/h3-4,6-7H,2,5H2,1H3
- InChIKey
- UGAXDAGIKIVCQB-UHFFFAOYSA-N
- Compound name
- 1-nitro-2-propylbenzene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 166.08626 | 133.6 |
| [M+Na]+ | 188.06820 | 141.0 |
| [M-H]- | 164.07170 | 137.5 |
| [M+NH4]+ | 183.11280 | 153.7 |
| [M+K]+ | 204.04214 | 135.4 |
| [M+H-H2O]+ | 148.07624 | 132.7 |
| [M+HCOO]- | 210.07718 | 159.5 |
| [M+CH3COO]- | 224.09283 | 173.9 |
| [M+Na-2H]- | 186.05365 | 141.8 |
| [M]+ | 165.07843 | 133.0 |
| [M]- | 165.07953 | 133.0 |