CID 135742246
5-nitroquinazolin-4-ol
Structural Information
- Molecular Formula
- C8H5N3O3
- SMILES
- C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)NC=N2
- InChI
- InChI=1S/C8H5N3O3/c12-8-7-5(9-4-10-8)2-1-3-6(7)11(13)14/h1-4H,(H,9,10,12)
- InChIKey
- AGOKBMXSQJZEKF-UHFFFAOYSA-N
- Compound name
- 5-nitro-3H-quinazolin-4-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 192.04038 | 133.0 |
| [M+Na]+ | 214.02232 | 142.4 |
| [M-H]- | 190.02582 | 134.4 |
| [M+NH4]+ | 209.06692 | 149.5 |
| [M+K]+ | 229.99626 | 134.9 |
| [M+H-H2O]+ | 174.03036 | 130.5 |
| [M+HCOO]- | 236.03130 | 155.2 |
| [M+CH3COO]- | 250.04695 | 173.2 |
| [M+Na-2H]- | 212.00777 | 144.8 |
| [M]+ | 191.03255 | 130.8 |
| [M]- | 191.03365 | 130.8 |