CID 135511888
5'-s-methyl-5'-thioinosine
Structural Information
- Molecular Formula
- C11H14N4O4S
- SMILES
- CSC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CNC3=O)O)O
- InChI
- InChI=1S/C11H14N4O4S/c1-20-2-5-7(16)8(17)11(19-5)15-4-14-6-9(15)12-3-13-10(6)18/h3-5,7-8,11,16-17H,2H2,1H3,(H,12,13,18)/t5-,7-,8-,11-/m1/s1
- InChIKey
- GXYLOXCSJFJFKA-IOSLPCCCSA-N
- Compound name
- 9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(methylsulfanylmethyl)oxolan-2-yl]-1H-purin-6-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 299.08086 | 164.4 |
| [M+Na]+ | 321.06280 | 176.2 |
| [M-H]- | 297.06630 | 165.7 |
| [M+NH4]+ | 316.10740 | 177.1 |
| [M+K]+ | 337.03674 | 172.0 |
| [M+H-H2O]+ | 281.07084 | 158.5 |
| [M+HCOO]- | 343.07178 | 175.5 |
| [M+CH3COO]- | 357.08743 | 175.3 |
| [M+Na-2H]- | 319.04825 | 163.2 |
| [M]+ | 298.07303 | 168.3 |
| [M]- | 298.07413 | 168.3 |