CID 135480618
2-amino-6-benzyl-5-bromo-4(3h)-pyrimidinone
Structural Information
- Molecular Formula
- C11H10BrN3O
- SMILES
- C1=CC=C(C=C1)CC2=C(C(=O)NC(=N2)N)Br
- InChI
- InChI=1S/C11H10BrN3O/c12-9-8(14-11(13)15-10(9)16)6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,13,14,15,16)
- InChIKey
- USKQHNKZJKSXGL-UHFFFAOYSA-N
- Compound name
- 2-amino-4-benzyl-5-bromo-1H-pyrimidin-6-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 280.00801 | 150.9 |
| [M+Na]+ | 301.98995 | 163.0 |
| [M-H]- | 277.99345 | 156.3 |
| [M+NH4]+ | 297.03455 | 167.0 |
| [M+K]+ | 317.96389 | 149.5 |
| [M+H-H2O]+ | 261.99799 | 148.9 |
| [M+HCOO]- | 323.99893 | 170.4 |
| [M+CH3COO]- | 338.01458 | 194.6 |
| [M+Na-2H]- | 299.97540 | 158.3 |
| [M]+ | 279.00018 | 167.1 |
| [M]- | 279.00128 | 167.1 |