CID 135480603
Schembl9827036
Structural Information
- Molecular Formula
- C12H19N5O4
- SMILES
- CC(C)OCC(CO)OCN1C=NC2=C1N=C(NC2=O)N
- InChI
- InChI=1S/C12H19N5O4/c1-7(2)20-4-8(3-18)21-6-17-5-14-9-10(17)15-12(13)16-11(9)19/h5,7-8,18H,3-4,6H2,1-2H3,(H3,13,15,16,19)
- InChIKey
- WPGDZJQNTXKQRN-UHFFFAOYSA-N
- Compound name
- 2-amino-9-[(1-hydroxy-3-propan-2-yloxypropan-2-yl)oxymethyl]-1H-purin-6-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 298.15098 | 166.5 |
| [M+Na]+ | 320.13292 | 175.0 |
| [M-H]- | 296.13642 | 163.7 |
| [M+NH4]+ | 315.17752 | 177.5 |
| [M+K]+ | 336.10686 | 171.7 |
| [M+H-H2O]+ | 280.14096 | 157.9 |
| [M+HCOO]- | 342.14190 | 183.2 |
| [M+CH3COO]- | 356.15755 | 201.2 |
| [M+Na-2H]- | 318.11837 | 169.0 |
| [M]+ | 297.14315 | 170.0 |
| [M]- | 297.14425 | 170.0 |