CID 135459822
Ganciclovir di-o-acetate
Structural Information
- Molecular Formula
- C13H17N5O6
- SMILES
- CC(=O)OCC(COC(=O)C)OCN1C=NC2=C1N=C(NC2=O)N
- InChI
- InChI=1S/C13H17N5O6/c1-7(19)22-3-9(4-23-8(2)20)24-6-18-5-15-10-11(18)16-13(14)17-12(10)21/h5,9H,3-4,6H2,1-2H3,(H3,14,16,17,21)
- InChIKey
- NSZKHEYZLNPIEJ-UHFFFAOYSA-N
- Compound name
- [3-acetyloxy-2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]propyl] acetate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 340.12518 | 173.0 |
| [M+Na]+ | 362.10712 | 181.3 |
| [M-H]- | 338.11062 | 171.7 |
| [M+NH4]+ | 357.15172 | 182.7 |
| [M+K]+ | 378.08106 | 179.5 |
| [M+H-H2O]+ | 322.11516 | 164.1 |
| [M+HCOO]- | 384.11610 | 190.6 |
| [M+CH3COO]- | 398.13175 | 209.1 |
| [M+Na-2H]- | 360.09257 | 174.8 |
| [M]+ | 339.11735 | 179.2 |
| [M]- | 339.11845 | 179.2 |