CID 135436526
1-methyl-3-nitro-1-nitrosoguanidine
Structural Information
- Molecular Formula
- C2H5N5O3
- SMILES
- CN(C(=N)N[N+](=O)[O-])N=O
- InChI
- InChI=1S/C2H5N5O3/c1-6(5-8)2(3)4-7(9)10/h1H3,(H2,3,4)
- InChIKey
- VZUNGTLZRAYYDE-UHFFFAOYSA-N
- Compound name
- 1-methyl-3-nitro-1-nitrosoguanidine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 148.04653 | 121.0 |
| [M+Na]+ | 170.02847 | 126.4 |
| [M-H]- | 146.03197 | 124.5 |
| [M+NH4]+ | 165.07307 | 141.1 |
| [M+K]+ | 186.00241 | 125.2 |
| [M+H-H2O]+ | 130.03651 | 119.0 |
| [M+HCOO]- | 192.03745 | 152.7 |
| [M+CH3COO]- | 206.05310 | 181.1 |
| [M+Na-2H]- | 168.01392 | 130.7 |
| [M]+ | 147.03870 | 118.5 |
| [M]- | 147.03980 | 118.5 |