CID 135411106
Schembl13754873
Structural Information
- Molecular Formula
- C15H13NO4
- SMILES
- C1=CC=C(C=C1)COC2=CC=CC(=N2)/C=C(/C(=O)O)\O
- InChI
- InChI=1S/C15H13NO4/c17-13(15(18)19)9-12-7-4-8-14(16-12)20-10-11-5-2-1-3-6-11/h1-9,17H,10H2,(H,18,19)/b13-9-
- InChIKey
- NSFDDLDBGIFSHM-LCYFTJDESA-N
- Compound name
- (Z)-2-hydroxy-3-(6-phenylmethoxypyridin-2-yl)prop-2-enoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 272.09175 | 160.3 |
| [M+Na]+ | 294.07369 | 166.2 |
| [M-H]- | 270.07719 | 162.8 |
| [M+NH4]+ | 289.11829 | 173.1 |
| [M+K]+ | 310.04763 | 162.3 |
| [M+H-H2O]+ | 254.08173 | 152.1 |
| [M+HCOO]- | 316.08267 | 179.2 |
| [M+CH3COO]- | 330.09832 | 191.5 |
| [M+Na-2H]- | 292.05914 | 163.9 |
| [M]+ | 271.08392 | 159.8 |
| [M]- | 271.08502 | 159.8 |