CID 135151360
2230820-11-6
Structural Information
- Molecular Formula
- C18H20N8O2
- SMILES
- CC1=CC2=NC=NN2C=C1NC3=NC=C4C(=N3)N(C(=O)N4C)C5CCOCC5
- InChI
- InChI=1S/C18H20N8O2/c1-11-7-15-20-10-21-25(15)9-13(11)22-17-19-8-14-16(23-17)26(18(27)24(14)2)12-3-5-28-6-4-12/h7-10,12H,3-6H2,1-2H3,(H,19,22,23)
- InChIKey
- XISVSTPEXYIKJL-UHFFFAOYSA-N
- Compound name
- 7-methyl-2-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]-9-(oxan-4-yl)purin-8-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 381.17821 | 191.7 |
| [M+Na]+ | 403.16015 | 203.7 |
| [M-H]- | 379.16365 | 196.9 |
| [M+NH4]+ | 398.20475 | 198.0 |
| [M+K]+ | 419.13409 | 197.1 |
| [M+H-H2O]+ | 363.16819 | 179.6 |
| [M+HCOO]- | 425.16913 | 206.2 |
| [M+CH3COO]- | 439.18478 | 200.7 |
| [M+Na-2H]- | 401.14560 | 193.5 |
| [M]+ | 380.17038 | 195.0 |
| [M]- | 380.17148 | 195.0 |