CID 13026
2,3,5-trihydroxytoluene
Structural Information
- Molecular Formula
- C7H8O3
- SMILES
- CC1=CC(=CC(=C1O)O)O
- InChI
- InChI=1S/C7H8O3/c1-4-2-5(8)3-6(9)7(4)10/h2-3,8-10H,1H3
- InChIKey
- GIGNQZIJYUEWTI-UHFFFAOYSA-N
- Compound name
- 6-methylbenzene-1,2,4-triol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 141.05463 | 124.6 |
| [M+Na]+ | 163.03657 | 134.3 |
| [M-H]- | 139.04007 | 125.4 |
| [M+NH4]+ | 158.08117 | 144.9 |
| [M+K]+ | 179.01051 | 131.8 |
| [M+H-H2O]+ | 123.04461 | 120.4 |
| [M+HCOO]- | 185.04555 | 145.9 |
| [M+CH3COO]- | 199.06120 | 167.1 |
| [M+Na-2H]- | 161.02202 | 130.3 |
| [M]+ | 140.04680 | 123.6 |
| [M]- | 140.04790 | 123.6 |