CID 12703366
2,4-dichloro-6-nitroquinazoline
Structural Information
- Molecular Formula
- C8H3Cl2N3O2
- SMILES
- C1=CC2=C(C=C1[N+](=O)[O-])C(=NC(=N2)Cl)Cl
- InChI
- InChI=1S/C8H3Cl2N3O2/c9-7-5-3-4(13(14)15)1-2-6(5)11-8(10)12-7/h1-3H
- InChIKey
- HGHPXBLOAQXDCO-UHFFFAOYSA-N
- Compound name
- 2,4-dichloro-6-nitroquinazoline
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 243.96752 | 143.7 |
| [M+Na]+ | 265.94946 | 154.4 |
| [M-H]- | 241.95296 | 145.1 |
| [M+NH4]+ | 260.99406 | 160.1 |
| [M+K]+ | 281.92340 | 145.7 |
| [M+H-H2O]+ | 225.95750 | 142.3 |
| [M+HCOO]- | 287.95844 | 156.9 |
| [M+CH3COO]- | 301.97409 | 184.5 |
| [M+Na-2H]- | 263.93491 | 153.2 |
| [M]+ | 242.95969 | 145.9 |
| [M]- | 242.96079 | 145.9 |