CID 12447405
Bicyclo[4.3.1]decan-8-one
Structural Information
- Molecular Formula
- C10H16O
- SMILES
- C1CCC2CC(C1)CC(=O)C2
- InChI
- InChI=1S/C10H16O/c11-10-6-8-3-1-2-4-9(5-8)7-10/h8-9H,1-7H2
- InChIKey
- QEFLRRDCPNUYBA-UHFFFAOYSA-N
- Compound name
- bicyclo[4.3.1]decan-8-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 153.12740 | 128.5 |
| [M+Na]+ | 175.10934 | 131.9 |
| [M-H]- | 151.11284 | 131.7 |
| [M+NH4]+ | 170.15394 | 149.7 |
| [M+K]+ | 191.08328 | 133.3 |
| [M+H-H2O]+ | 135.11738 | 124.9 |
| [M+HCOO]- | 197.11832 | 145.2 |
| [M+CH3COO]- | 211.13397 | 179.1 |
| [M+Na-2H]- | 173.09479 | 134.6 |
| [M]+ | 152.11957 | 120.6 |
| [M]- | 152.12067 | 120.6 |