CID 12434663
(2-methyl-1,3-dioxolan-2-yl)methanamine
Structural Information
- Molecular Formula
- C5H11NO2
- SMILES
- CC1(OCCO1)CN
- InChI
- InChI=1S/C5H11NO2/c1-5(4-6)7-2-3-8-5/h2-4,6H2,1H3
- InChIKey
- BVVSUFVLGBJYOR-UHFFFAOYSA-N
- Compound name
- (2-methyl-1,3-dioxolan-2-yl)methanamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 118.08626 | 121.4 |
| [M+Na]+ | 140.06820 | 128.3 |
| [M-H]- | 116.07170 | 125.6 |
| [M+NH4]+ | 135.11280 | 144.3 |
| [M+K]+ | 156.04214 | 130.5 |
| [M+H-H2O]+ | 100.07624 | 117.3 |
| [M+HCOO]- | 162.07718 | 143.9 |
| [M+CH3COO]- | 176.09283 | 167.8 |
| [M+Na-2H]- | 138.05365 | 129.9 |
| [M]+ | 117.07843 | 120.2 |
| [M]- | 117.07953 | 120.2 |