CID 12430169
3-ethynylcyclohexan-1-one
Structural Information
- Molecular Formula
- C8H10O
- SMILES
- C#CC1CCCC(=O)C1
- InChI
- InChI=1S/C8H10O/c1-2-7-4-3-5-8(9)6-7/h1,7H,3-6H2
- InChIKey
- MXEXGWVDPLEEMV-UHFFFAOYSA-N
- Compound name
- 3-ethynylcyclohexan-1-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 123.08044 | 123.5 |
| [M+Na]+ | 145.06238 | 132.6 |
| [M-H]- | 121.06589 | 125.7 |
| [M+NH4]+ | 140.10699 | 143.5 |
| [M+K]+ | 161.03632 | 129.2 |
| [M+H-H2O]+ | 105.07043 | 112.9 |
| [M+HCOO]- | 167.07137 | 139.3 |
| [M+CH3COO]- | 181.08702 | 179.3 |
| [M+Na-2H]- | 143.04783 | 128.3 |
| [M]+ | 122.07262 | 114.6 |
| [M]- | 122.07371 | 114.6 |