CID 12199115
1-ethoxy-2,4-pentanedione
Structural Information
- Molecular Formula
- C7H12O3
- SMILES
- CCOCC(=O)CC(=O)C
- InChI
- InChI=1S/C7H12O3/c1-3-10-5-7(9)4-6(2)8/h3-5H2,1-2H3
- InChIKey
- SSVCOUCWPBSLAE-UHFFFAOYSA-N
- Compound name
- 1-ethoxypentane-2,4-dione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 145.08592 | 129.5 |
| [M+Na]+ | 167.06786 | 136.5 |
| [M-H]- | 143.07136 | 129.9 |
| [M+NH4]+ | 162.11246 | 151.0 |
| [M+K]+ | 183.04180 | 137.2 |
| [M+H-H2O]+ | 127.07590 | 124.9 |
| [M+HCOO]- | 189.07684 | 152.2 |
| [M+CH3COO]- | 203.09249 | 176.0 |
| [M+Na-2H]- | 165.05331 | 133.7 |
| [M]+ | 144.07809 | 132.9 |
| [M]- | 144.07919 | 132.9 |