CID 121138
Succinic acid mono-3-amino-2,4,6-triiodo-n-ethylanilide
Structural Information
- Molecular Formula
- C12H13I3N2O3
- SMILES
- CCN(C1=C(C=C(C(=C1I)N)I)I)C(=O)CCC(=O)O
- InChI
- InChI=1S/C12H13I3N2O3/c1-2-17(8(18)3-4-9(19)20)12-7(14)5-6(13)11(16)10(12)15/h5H,2-4,16H2,1H3,(H,19,20)
- InChIKey
- LCXACUQONAQZBR-UHFFFAOYSA-N
- Compound name
- 4-(3-amino-N-ethyl-2,4,6-triiodoanilino)-4-oxobutanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 614.81328 | 182.5 |
| [M+Na]+ | 636.79522 | 169.4 |
| [M-H]- | 612.79872 | 173.1 |
| [M+NH4]+ | 631.83982 | 183.0 |
| [M+K]+ | 652.76916 | 183.4 |
| [M+H-H2O]+ | 596.80326 | 169.8 |
| [M+HCOO]- | 658.80420 | 186.9 |
| [M+CH3COO]- | 672.81985 | 236.3 |
| [M+Na-2H]- | 634.78067 | 163.5 |
| [M]+ | 613.80545 | 177.0 |
| [M]- | 613.80655 | 177.0 |