CID 11537241
2-furancarboxamide, n-[3-(4-methyl-1-piperazinyl)phenyl]-5-nitro-
Structural Information
- Molecular Formula
- C16H18N4O4
- SMILES
- CN1CCN(CC1)C2=CC=CC(=C2)NC(=O)C3=CC=C(O3)[N+](=O)[O-]
- InChI
- InChI=1S/C16H18N4O4/c1-18-7-9-19(10-8-18)13-4-2-3-12(11-13)17-16(21)14-5-6-15(24-14)20(22)23/h2-6,11H,7-10H2,1H3,(H,17,21)
- InChIKey
- ORLMGKXNLDGPBF-UHFFFAOYSA-N
- Compound name
- N-[3-(4-methylpiperazin-1-yl)phenyl]-5-nitrofuran-2-carboxamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 331.14008 | 174.8 |
| [M+Na]+ | 353.12202 | 178.2 |
| [M-H]- | 329.12552 | 182.3 |
| [M+NH4]+ | 348.16662 | 184.3 |
| [M+K]+ | 369.09596 | 171.9 |
| [M+H-H2O]+ | 313.13006 | 169.2 |
| [M+HCOO]- | 375.13100 | 194.2 |
| [M+CH3COO]- | 389.14665 | 203.7 |
| [M+Na-2H]- | 351.10747 | 178.8 |
| [M]+ | 330.13225 | 170.4 |
| [M]- | 330.13335 | 170.4 |