CID 11435522
5-methoxy-2-(methoxymethoxy)benzaldehyde
Structural Information
- Molecular Formula
- C10H12O4
- SMILES
- COCOC1=C(C=C(C=C1)OC)C=O
- InChI
- InChI=1S/C10H12O4/c1-12-7-14-10-4-3-9(13-2)5-8(10)6-11/h3-6H,7H2,1-2H3
- InChIKey
- WSMHWPOBGUNBJR-UHFFFAOYSA-N
- Compound name
- 5-methoxy-2-(methoxymethoxy)benzaldehyde
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 197.08084 | 138.1 |
| [M+Na]+ | 219.06278 | 147.1 |
| [M-H]- | 195.06628 | 142.3 |
| [M+NH4]+ | 214.10738 | 158.0 |
| [M+K]+ | 235.03672 | 146.6 |
| [M+H-H2O]+ | 179.07082 | 132.2 |
| [M+HCOO]- | 241.07176 | 163.5 |
| [M+CH3COO]- | 255.08741 | 183.9 |
| [M+Na-2H]- | 217.04823 | 144.6 |
| [M]+ | 196.07301 | 144.4 |
| [M]- | 196.07411 | 144.4 |