CID 11409499
Mesosulfuron-methyl
Structural Information
- Molecular Formula
- C17H21N5O9S2
- SMILES
- COC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)C2=C(C=CC(=C2)CNS(=O)(=O)C)C(=O)OC)OC
- InChI
- InChI=1S/C17H21N5O9S2/c1-29-13-8-14(30-2)20-16(19-13)21-17(24)22-33(27,28)12-7-10(9-18-32(4,25)26)5-6-11(12)15(23)31-3/h5-8,18H,9H2,1-4H3,(H2,19,20,21,22,24)
- InChIKey
- NIFKBBMCXCMCAO-UHFFFAOYSA-N
- Compound name
- methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 504.08534 | 208.9 |
| [M+Na]+ | 526.06728 | 212.5 |
| [M-H]- | 502.07078 | 211.9 |
| [M+NH4]+ | 521.11188 | 211.4 |
| [M+K]+ | 542.04122 | 209.5 |
| [M+H-H2O]+ | 486.07532 | 199.2 |
| [M+HCOO]- | 548.07626 | 219.0 |
| [M+CH3COO]- | 562.09191 | 240.3 |
| [M+Na-2H]- | 524.05273 | 214.4 |
| [M]+ | 503.07751 | 216.8 |
| [M]- | 503.07861 | 216.8 |