CID 11303553
4-methylhexacosane
Structural Information
- Molecular Formula
- C27H56
- SMILES
- CCCCCCCCCCCCCCCCCCCCCCC(C)CCC
- InChI
- InChI=1S/C27H56/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-27(3)25-5-2/h27H,4-26H2,1-3H3
- InChIKey
- RWVONPYEUYBBJH-UHFFFAOYSA-N
- Compound name
- 4-methylhexacosane
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 381.44548 | 214.3 |
| [M+Na]+ | 403.42742 | 212.6 |
| [M-H]- | 379.43092 | 210.6 |
| [M+NH4]+ | 398.47202 | 226.5 |
| [M+K]+ | 419.40136 | 207.3 |
| [M+H-H2O]+ | 363.43546 | 206.1 |
| [M+HCOO]- | 425.43640 | 230.1 |
| [M+CH3COO]- | 439.45205 | 231.0 |
| [M+Na-2H]- | 401.41287 | 208.8 |
| [M]+ | 380.43765 | 222.9 |
| [M]- | 380.43875 | 222.9 |