CID 11245
1,1-dichloropropene
Structural Information
- Molecular Formula
- C3H4Cl2
- SMILES
- CC=C(Cl)Cl
- InChI
- InChI=1S/C3H4Cl2/c1-2-3(4)5/h2H,1H3
- InChIKey
- ZAIDIVBQUMFXEC-UHFFFAOYSA-N
- Compound name
- 1,1-dichloroprop-1-ene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 110.97628 | 114.8 |
| [M+Na]+ | 132.95822 | 124.5 |
| [M-H]- | 108.96172 | 114.9 |
| [M+NH4]+ | 128.00282 | 138.9 |
| [M+K]+ | 148.93216 | 121.1 |
| [M+H-H2O]+ | 92.966260 | 113.1 |
| [M+HCOO]- | 154.96720 | 129.1 |
| [M+CH3COO]- | 168.98285 | 166.6 |
| [M+Na-2H]- | 130.94367 | 121.3 |
| [M]+ | 109.96845 | 116.0 |
| [M]- | 109.96955 | 116.0 |