CID 11194758
3-fluoro-4'-methyl-1,1'-biphenyl
Structural Information
- Molecular Formula
- C13H11F
- SMILES
- CC1=CC=C(C=C1)C2=CC(=CC=C2)F
- InChI
- InChI=1S/C13H11F/c1-10-5-7-11(8-6-10)12-3-2-4-13(14)9-12/h2-9H,1H3
- InChIKey
- BGVOIDLAUFLERQ-UHFFFAOYSA-N
- Compound name
- 1-fluoro-3-(4-methylphenyl)benzene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 187.09175 | 136.8 |
| [M+Na]+ | 209.07369 | 145.9 |
| [M-H]- | 185.07719 | 142.8 |
| [M+NH4]+ | 204.11829 | 156.8 |
| [M+K]+ | 225.04763 | 141.9 |
| [M+H-H2O]+ | 169.08173 | 129.4 |
| [M+HCOO]- | 231.08267 | 160.6 |
| [M+CH3COO]- | 245.09832 | 184.1 |
| [M+Na-2H]- | 207.05914 | 143.6 |
| [M]+ | 186.08392 | 135.3 |
| [M]- | 186.08502 | 135.3 |