CID 11096817
(4-hydroxyphenyl)(4-nitrophenyl)methanone
Structural Information
- Molecular Formula
- C13H9NO4
- SMILES
- C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)O)[N+](=O)[O-]
- InChI
- InChI=1S/C13H9NO4/c15-12-7-3-10(4-8-12)13(16)9-1-5-11(6-2-9)14(17)18/h1-8,15H
- InChIKey
- ZEYDQRVULMQZIU-UHFFFAOYSA-N
- Compound name
- (4-hydroxyphenyl)-(4-nitrophenyl)methanone
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 244.06044 | 150.1 |
| [M+Na]+ | 266.04238 | 156.7 |
| [M-H]- | 242.04588 | 155.9 |
| [M+NH4]+ | 261.08698 | 165.6 |
| [M+K]+ | 282.01632 | 149.6 |
| [M+H-H2O]+ | 226.05042 | 147.5 |
| [M+HCOO]- | 288.05136 | 174.0 |
| [M+CH3COO]- | 302.06701 | 183.9 |
| [M+Na-2H]- | 264.02783 | 156.7 |
| [M]+ | 243.05261 | 148.1 |
| [M]- | 243.05371 | 148.1 |