CID 108589
2-amino-4-methoxybenzene-1-thiol
Structural Information
- Molecular Formula
- C7H9NOS
- SMILES
- COC1=CC(=C(C=C1)S)N
- InChI
- InChI=1S/C7H9NOS/c1-9-5-2-3-7(10)6(8)4-5/h2-4,10H,8H2,1H3
- InChIKey
- KIDLBEYNOGVICH-UHFFFAOYSA-N
- Compound name
- 2-amino-4-methoxybenzenethiol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 156.04776 | 128.1 |
| [M+Na]+ | 178.02970 | 137.5 |
| [M-H]- | 154.03320 | 132.3 |
| [M+NH4]+ | 173.07430 | 149.7 |
| [M+K]+ | 194.00364 | 135.0 |
| [M+H-H2O]+ | 138.03774 | 122.7 |
| [M+HCOO]- | 200.03868 | 148.5 |
| [M+CH3COO]- | 214.05433 | 177.5 |
| [M+Na-2H]- | 176.01515 | 131.9 |
| [M]+ | 155.03993 | 129.9 |
| [M]- | 155.04103 | 129.9 |