CID 107501
Clomestrone
Structural Information
- Molecular Formula
- C19H23ClO2
- SMILES
- C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H](C2=O)Cl)CCC4=C3C=CC(=C4)OC
- InChI
- InChI=1S/C19H23ClO2/c1-19-8-7-14-13-6-4-12(22-2)9-11(13)3-5-15(14)16(19)10-17(20)18(19)21/h4,6,9,14-17H,3,5,7-8,10H2,1-2H3/t14-,15-,16+,17-,19+/m1/s1
- InChIKey
- UQIPVSBPFZSWGD-ILYVXUQDSA-N
- Compound name
- (8R,9S,13S,14S,16R)-16-chloro-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 319.14595 | 176.0 |
| [M+Na]+ | 341.12789 | 184.6 |
| [M-H]- | 317.13139 | 181.3 |
| [M+NH4]+ | 336.17249 | 198.5 |
| [M+K]+ | 357.10183 | 177.6 |
| [M+H-H2O]+ | 301.13593 | 170.3 |
| [M+HCOO]- | 363.13687 | 185.8 |
| [M+CH3COO]- | 377.15252 | 186.7 |
| [M+Na-2H]- | 339.11334 | 176.9 |
| [M]+ | 318.13812 | 175.4 |
| [M]- | 318.13922 | 175.4 |