CID 104454
4-thiazoleacetic acid, 2-amino-, ethyl ester
Structural Information
- Molecular Formula
- C7H10N2O2S
- SMILES
- CCOC(=O)CC1=CSC(=N1)N
- InChI
- InChI=1S/C7H10N2O2S/c1-2-11-6(10)3-5-4-12-7(8)9-5/h4H,2-3H2,1H3,(H2,8,9)
- InChIKey
- SHQNGLYXRFCPGZ-UHFFFAOYSA-N
- Compound name
- ethyl 2-(2-amino-1,3-thiazol-4-yl)acetate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 187.05358 | 138.4 |
| [M+Na]+ | 209.03552 | 146.9 |
| [M-H]- | 185.03902 | 140.9 |
| [M+NH4]+ | 204.08012 | 158.9 |
| [M+K]+ | 225.00946 | 145.1 |
| [M+H-H2O]+ | 169.04356 | 132.1 |
| [M+HCOO]- | 231.04450 | 157.8 |
| [M+CH3COO]- | 245.06015 | 180.4 |
| [M+Na-2H]- | 207.02097 | 139.5 |
| [M]+ | 186.04575 | 141.1 |
| [M]- | 186.04685 | 141.1 |