CID 101078513
African-3-ene
Structural Information
- Molecular Formula
- C15H24
- SMILES
- CC1=CC[C@@H]2[C@@H]1CC(C[C@@H]3[C@]2(C3)C)(C)C
- InChI
- InChI=1S/C15H24/c1-10-5-6-13-12(10)9-14(2,3)7-11-8-15(11,13)4/h5,11-13H,6-9H2,1-4H3/t11-,12+,13+,15+/m0/s1
- InChIKey
- LOWGZUQIXFZBPD-KYEXWDHISA-N
- Compound name
- (1aS,4aS,7aR,7bR)-3,3,5,7b-tetramethyl-1a,2,4,4a,7,7a-hexahydro-1H-cyclopropa[e]azulene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 205.19508 | 142.9 |
| [M+Na]+ | 227.17702 | 151.3 |
| [M-H]- | 203.18052 | 150.0 |
| [M+NH4]+ | 222.22162 | 163.7 |
| [M+K]+ | 243.15096 | 149.9 |
| [M+H-H2O]+ | 187.18506 | 139.7 |
| [M+HCOO]- | 249.18600 | 159.8 |
| [M+CH3COO]- | 263.20165 | 155.4 |
| [M+Na-2H]- | 225.16247 | 147.3 |
| [M]+ | 204.18725 | 142.3 |
| [M]- | 204.18835 | 142.3 |