CID 10101610
Rpkpqq
Structural Information
- Molecular Formula
- C32H56N12O9
- SMILES
- C1C[C@H](N(C1)C(=O)[C@H](CCCN=C(N)N)N)C(=O)N[C@@H](CCCCN)C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)O
- InChI
- InChI=1S/C32H56N12O9/c33-14-2-1-7-20(41-28(49)22-8-4-16-43(22)29(50)18(34)6-3-15-39-32(37)38)30(51)44-17-5-9-23(44)27(48)40-19(10-12-24(35)45)26(47)42-21(31(52)53)11-13-25(36)46/h18-23H,1-17,33-34H2,(H2,35,45)(H2,36,46)(H,40,48)(H,41,49)(H,42,47)(H,52,53)(H4,37,38,39)/t18-,19-,20-,21-,22-,23-/m0/s1
- InChIKey
- UFTDINHLCHPVEW-LLINQDLYSA-N
- Compound name
- (2S)-5-amino-2-[[(2S)-5-amino-2-[[(2S)-1-[(2S)-6-amino-2-[[(2S)-1-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 753.43658 | 266.1 |
| [M+Na]+ | 775.41852 | 260.3 |
| [M-H]- | 751.42202 | 266.1 |
| [M+NH4]+ | 770.46312 | 266.2 |
| [M+K]+ | 791.39246 | 268.1 |
| [M+H-H2O]+ | 735.42656 | 243.3 |
| [M+HCOO]- | 797.42750 | 266.4 |
| [M+CH3COO]- | 811.44315 | 268.9 |
| [M+Na-2H]- | 773.40397 | 297.1 |
| [M]+ | 752.42875 | 295.3 |
| [M]- | 752.42985 | 295.3 |